C16H22O3 — CID 83941765
2-[2-(4-ethoxy-2-ethylphenyl)ethyl]cyclopropane-1-carboxylic acid (PubChem CID 83941765) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[2-(4-ethoxy-2-ethylphenyl)ethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[2-(4-ethoxy-2-ethylphenyl)ethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 83941765 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-[2-(4-ethoxy-2-ethylphenyl)ethyl]cyclopropane-1-carboxylic acid |
| SMILES | CCOc1ccc(CCC2CC2C(=O)O)c(CC)c1 |
| InChI | InChI=1S/C16H22O3/c1-3-11-9-14(19-4-2)8-7-12(11)5-6-13-10-15(13)16(17)18/h7-9,13,15H,3-6,10H2,1-2H3,(H,17,18) |
| InChIKey | CGJFDJTXFMHHAZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |