C16H23F3N2O — CID 171620346
N-[[2-ethoxy-5-(trifluoromethyl)phenyl]methyl]-1-piperidin-4-ylmethanamine (PubChem CID 171620346) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is N-[[2-ethoxy-5-(trifluoromethyl)phenyl]methyl]-1-piperidin-4-ylmethanamine.
| Compound Name | N-[[2-ethoxy-5-(trifluoromethyl)phenyl]methyl]-1-piperidin-4-ylmethanamine |
|---|---|
| PubChem CID | 171620346 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[[2-ethoxy-5-(trifluoromethyl)phenyl]methyl]-1-piperidin-4-ylmethanamine |
| SMILES | CCOc1ccc(C(F)(F)F)cc1CNCC1CCNCC1 |
| InChI | InChI=1S/C16H23F3N2O/c1-2-22-15-4-3-14(16(17,18)19)9-13(15)11-21-10-12-5-7-20-8-6-12/h3-4,9,12,20-21H,2,5-8,10-11H2,1H3 |
| InChIKey | VBDZXXOQDQUEPU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |