C15H24Cl2N2O2 — CID 171620485
2-[4-chloro-2-[(piperidin-4-ylmethylamino)methyl]phenoxy]ethanol;hydrochloride (PubChem CID 171620485) has the molecular formula C15H24Cl2N2O2 and a molecular weight of 335.28 g/mol. Its IUPAC name is 2-[4-chloro-2-[(piperidin-4-ylmethylamino)methyl]phenoxy]ethanol;hydrochloride.
| Compound Name | 2-[4-chloro-2-[(piperidin-4-ylmethylamino)methyl]phenoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 171620485 |
| Molecular Formula | C15H24Cl2N2O2 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[4-chloro-2-[(piperidin-4-ylmethylamino)methyl]phenoxy]ethanol;hydrochloride |
| SMILES | Cl.OCCOc1ccc(Cl)cc1CNCC1CCNCC1 |
| InChI | InChI=1S/C15H23ClN2O2.ClH/c16-14-1-2-15(20-8-7-19)13(9-14)11-18-10-12-3-5-17-6-4-12;/h1-2,9,12,17-19H,3-8,10-11H2;1H |
| InChIKey | XMFCCJMZNAOZAK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |