C20H37ClN2O2 — CID 171620367
N-[[4-chloro-2-(2-methoxyethoxy)phenyl]methyl]-1-piperidin-4-ylmethanamine;ethane (PubChem CID 171620367) has the molecular formula C20H37ClN2O2 and a molecular weight of 372.98 g/mol. Its IUPAC name is N-[[4-chloro-2-(2-methoxyethoxy)phenyl]methyl]-1-piperidin-4-ylmethanamine;ethane.
| Compound Name | N-[[4-chloro-2-(2-methoxyethoxy)phenyl]methyl]-1-piperidin-4-ylmethanamine;ethane |
|---|---|
| PubChem CID | 171620367 |
| Molecular Formula | C20H37ClN2O2 |
| Molecular Weight | 372.98 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-[[4-chloro-2-(2-methoxyethoxy)phenyl]methyl]-1-piperidin-4-ylmethanamine;ethane |
| SMILES | CC.CC.COCCOc1cc(Cl)ccc1CNCC1CCNCC1 |
| InChI | InChI=1S/C16H25ClN2O2.2C2H6/c1-20-8-9-21-16-10-15(17)3-2-14(16)12-19-11-13-4-6-18-7-5-13;2*1-2/h2-3,10,13,18-19H,4-9,11-12H2,1H3;2*1-2H3 |
| InChIKey | PPJJPSSEAJKDDO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|