C13H17F3O3 — CID 83921247
4-[2-ethoxy-5-(trifluoromethyl)phenyl]butane-1,2-diol (PubChem CID 83921247) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-[2-ethoxy-5-(trifluoromethyl)phenyl]butane-1,2-diol.
| Compound Name | 4-[2-ethoxy-5-(trifluoromethyl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 83921247 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-[2-ethoxy-5-(trifluoromethyl)phenyl]butane-1,2-diol |
| SMILES | CCOc1ccc(C(F)(F)F)cc1CCC(O)CO |
| InChI | InChI=1S/C13H17F3O3/c1-2-19-12-6-4-10(13(14,15)16)7-9(12)3-5-11(18)8-17/h4,6-7,11,17-18H,2-3,5,8H2,1H3 |
| InChIKey | KFMIWBHIPSAQEA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |