C15H22F3NO2 — CID 83921250
2-amino-5-[2-ethoxy-5-(trifluoromethyl)phenyl]hexan-3-ol (PubChem CID 83921250) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-amino-5-[2-ethoxy-5-(trifluoromethyl)phenyl]hexan-3-ol.
| Compound Name | 2-amino-5-[2-ethoxy-5-(trifluoromethyl)phenyl]hexan-3-ol |
|---|---|
| PubChem CID | 83921250 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-amino-5-[2-ethoxy-5-(trifluoromethyl)phenyl]hexan-3-ol |
| SMILES | CCOc1ccc(C(F)(F)F)cc1C(C)CC(O)C(C)N |
| InChI | InChI=1S/C15H22F3NO2/c1-4-21-14-6-5-11(15(16,17)18)8-12(14)9(2)7-13(20)10(3)19/h5-6,8-10,13,20H,4,7,19H2,1-3H3 |
| InChIKey | ILJSBHKLEDIGIO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |