C20H35NO2 — CID 83935661
5-amino-2-(5-tert-butyl-2-propoxyphenyl)heptan-4-ol (PubChem CID 83935661) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 5-amino-2-(5-tert-butyl-2-propoxyphenyl)heptan-4-ol.
| Compound Name | 5-amino-2-(5-tert-butyl-2-propoxyphenyl)heptan-4-ol |
|---|---|
| PubChem CID | 83935661 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | 5-amino-2-(5-tert-butyl-2-propoxyphenyl)heptan-4-ol |
| SMILES | CCCOc1ccc(C(C)(C)C)cc1C(C)CC(O)C(N)CC |
| InChI | InChI=1S/C20H35NO2/c1-7-11-23-19-10-9-15(20(4,5)6)13-16(19)14(3)12-18(22)17(21)8-2/h9-10,13-14,17-18,22H,7-8,11-12,21H2,1-6H3 |
| InChIKey | DGIBETALUUKGKF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |