C19H33NO2 — CID 83943004
4-amino-1-(3-tert-butyl-2-methoxy-5-methylphenyl)heptan-3-ol (PubChem CID 83943004) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 4-amino-1-(3-tert-butyl-2-methoxy-5-methylphenyl)heptan-3-ol.
| Compound Name | 4-amino-1-(3-tert-butyl-2-methoxy-5-methylphenyl)heptan-3-ol |
|---|---|
| PubChem CID | 83943004 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 4-amino-1-(3-tert-butyl-2-methoxy-5-methylphenyl)heptan-3-ol |
| SMILES | CCCC(N)C(O)CCc1cc(C)cc(C(C)(C)C)c1OC |
| InChI | InChI=1S/C19H33NO2/c1-7-8-16(20)17(21)10-9-14-11-13(2)12-15(18(14)22-6)19(3,4)5/h11-12,16-17,21H,7-10,20H2,1-6H3 |
| InChIKey | JLDZRWLPEJMQII-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |