C15H24ClNO3 — CID 83943375
4-amino-1-(5-chloro-2,4-dimethoxyphenyl)heptan-3-ol (PubChem CID 83943375) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is 4-amino-1-(5-chloro-2,4-dimethoxyphenyl)heptan-3-ol.
| Compound Name | 4-amino-1-(5-chloro-2,4-dimethoxyphenyl)heptan-3-ol |
|---|---|
| PubChem CID | 83943375 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-amino-1-(5-chloro-2,4-dimethoxyphenyl)heptan-3-ol |
| SMILES | CCCC(N)C(O)CCc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C15H24ClNO3/c1-4-5-12(17)13(18)7-6-10-8-11(16)15(20-3)9-14(10)19-2/h8-9,12-13,18H,4-7,17H2,1-3H3 |
| InChIKey | NSOPGJKLJCKYQQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |