C15H24ClNO2 — CID 83943152
1-(4-chloro-2,5-dimethoxyphenyl)heptan-4-amine (PubChem CID 83943152) has the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)heptan-4-amine.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)heptan-4-amine |
|---|---|
| PubChem CID | 83943152 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)heptan-4-amine |
| SMILES | CCCC(N)CCCc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C15H24ClNO2/c1-4-6-12(17)8-5-7-11-9-15(19-3)13(16)10-14(11)18-2/h9-10,12H,4-8,17H2,1-3H3 |
| InChIKey | IUVQPGCZJMTZDC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |