C17H28FNO2 — CID 83923067
1-(4,5-diethoxy-2-fluorophenyl)heptan-4-amine (PubChem CID 83923067) has the molecular formula C17H28FNO2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 1-(4,5-diethoxy-2-fluorophenyl)heptan-4-amine.
| Compound Name | 1-(4,5-diethoxy-2-fluorophenyl)heptan-4-amine |
|---|---|
| PubChem CID | 83923067 |
| Molecular Formula | C17H28FNO2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-(4,5-diethoxy-2-fluorophenyl)heptan-4-amine |
| SMILES | CCCC(N)CCCc1cc(OCC)c(OCC)cc1F |
| InChI | InChI=1S/C17H28FNO2/c1-4-8-14(19)10-7-9-13-11-16(20-5-2)17(21-6-3)12-15(13)18/h11-12,14H,4-10,19H2,1-3H3 |
| InChIKey | CXLOCEFDKDFBCH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |