C16H21FO2 — CID 83923131
1,2-diethoxy-4-fluoro-5-hex-3-ynylbenzene (PubChem CID 83923131) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is 1,2-diethoxy-4-fluoro-5-hex-3-ynylbenzene.
| Compound Name | 1,2-diethoxy-4-fluoro-5-hex-3-ynylbenzene |
|---|---|
| PubChem CID | 83923131 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1,2-diethoxy-4-fluoro-5-hex-3-ynylbenzene |
| SMILES | CCC#CCCc1cc(OCC)c(OCC)cc1F |
| InChI | InChI=1S/C16H21FO2/c1-4-7-8-9-10-13-11-15(18-5-2)16(19-6-3)12-14(13)17/h11-12H,4-6,9-10H2,1-3H3 |
| InChIKey | BBVTZHZZDVLNPQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|