C15H19FO2 — CID 83923128
1,2-diethoxy-4-fluoro-5-(2-methylbut-3-ynyl)benzene (PubChem CID 83923128) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 1,2-diethoxy-4-fluoro-5-(2-methylbut-3-ynyl)benzene.
| Compound Name | 1,2-diethoxy-4-fluoro-5-(2-methylbut-3-ynyl)benzene |
|---|---|
| PubChem CID | 83923128 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1,2-diethoxy-4-fluoro-5-(2-methylbut-3-ynyl)benzene |
| SMILES | C#CC(C)Cc1cc(OCC)c(OCC)cc1F |
| InChI | InChI=1S/C15H19FO2/c1-5-11(4)8-12-9-14(17-6-2)15(18-7-3)10-13(12)16/h1,9-11H,6-8H2,2-4H3 |
| InChIKey | MDQOMTJCYXPXDO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|