C17H27FO4 — CID 83923176
1-(4,5-diethoxy-2-fluorophenyl)heptane-3,4-diol (PubChem CID 83923176) has the molecular formula C17H27FO4 and a molecular weight of 314.40 g/mol. Its IUPAC name is 1-(4,5-diethoxy-2-fluorophenyl)heptane-3,4-diol.
| Compound Name | 1-(4,5-diethoxy-2-fluorophenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83923176 |
| Molecular Formula | C17H27FO4 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-(4,5-diethoxy-2-fluorophenyl)heptane-3,4-diol |
| SMILES | CCCC(O)C(O)CCc1cc(OCC)c(OCC)cc1F |
| InChI | InChI=1S/C17H27FO4/c1-4-7-14(19)15(20)9-8-12-10-16(21-5-2)17(22-6-3)11-13(12)18/h10-11,14-15,19-20H,4-9H2,1-3H3 |
| InChIKey | PUAHIRFZSSAXSE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |