C8H8F2O2 — CID 131306358
2-ethoxy-4,5-difluorophenol (PubChem CID 131306358) has the molecular formula C8H8F2O2 and a molecular weight of 174.15 g/mol. Its IUPAC name is 2-ethoxy-4,5-difluorophenol.
| Compound Name | 2-ethoxy-4,5-difluorophenol |
|---|---|
| PubChem CID | 131306358 |
| Molecular Formula | C8H8F2O2 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-ethoxy-4,5-difluorophenol |
| SMILES | CCOc1cc(F)c(F)cc1O |
| InChI | InChI=1S/C8H8F2O2/c1-2-12-8-4-6(10)5(9)3-7(8)11/h3-4,11H,2H2,1H3 |
| InChIKey | SLRUKLSSCMRFFN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |