About 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde
2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde (PubChem CID 83880628) has the molecular formula C10H10F2O2
and a molecular weight of 200.18 g/mol. Its IUPAC name is 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde |
| PubChem CID | 83880628 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde |
| SMILES | CCOc1cc(F)c(F)cc1CC=O |
| InChI | InChI=1S/C10H10F2O2/c1-2-14-10-6-9(12)8(11)5-7(10)3-4-13/h4-6H,2-3H2,1H3 |
| InChIKey | IZCXEKMGYQFRPU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde?
The IUPAC name of 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde (CID 83880628) is 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde.
What is the SMILES notation for 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde?
The canonical SMILES for 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde is CCOc1cc(F)c(F)cc1CC=O.
What is the InChIKey of 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde?
The InChIKey is IZCXEKMGYQFRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O2/c1-2-14-10-6-9(12)8(11)5-7(10)3-4-13/h4-6H,2-3H2,1H3.
What are the key properties of 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde?
2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde has a molecular weight of 200.18 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde is sourced from PubChem (CID 83880628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).