C10H10F2O2 — CID 83880628
2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde (PubChem CID 83880628) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde.
| Compound Name | 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 83880628 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(2-ethoxy-4,5-difluorophenyl)acetaldehyde |
| SMILES | CCOc1cc(F)c(F)cc1CC=O |
| InChI | InChI=1S/C10H10F2O2/c1-2-14-10-6-9(12)8(11)5-7(10)3-4-13/h4-6H,2-3H2,1H3 |
| InChIKey | IZCXEKMGYQFRPU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|