C14H22F2N2O — CID 177027717
1-[(2-ethoxy-4,5-difluorophenyl)methyl]pyrrolidine;methanamine (PubChem CID 177027717) has the molecular formula C14H22F2N2O and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-[(2-ethoxy-4,5-difluorophenyl)methyl]pyrrolidine;methanamine.
| Compound Name | 1-[(2-ethoxy-4,5-difluorophenyl)methyl]pyrrolidine;methanamine |
|---|---|
| PubChem CID | 177027717 |
| Molecular Formula | C14H22F2N2O |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-[(2-ethoxy-4,5-difluorophenyl)methyl]pyrrolidine;methanamine |
| SMILES | CCOc1cc(F)c(F)cc1CN1CCCC1.CN |
| InChI | InChI=1S/C13H17F2NO.CH5N/c1-2-17-13-8-12(15)11(14)7-10(13)9-16-5-3-4-6-16;1-2/h7-8H,2-6,9H2,1H3;2H2,1H3 |
| InChIKey | DFBWGRAEACSTTB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |