C14H23ClN2O2 — CID 171625093
2-[4-chloro-2-(pyrrolidin-1-ylmethyl)phenoxy]ethanol;methanamine (PubChem CID 171625093) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 2-[4-chloro-2-(pyrrolidin-1-ylmethyl)phenoxy]ethanol;methanamine.
| Compound Name | 2-[4-chloro-2-(pyrrolidin-1-ylmethyl)phenoxy]ethanol;methanamine |
|---|---|
| PubChem CID | 171625093 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-[4-chloro-2-(pyrrolidin-1-ylmethyl)phenoxy]ethanol;methanamine |
| SMILES | CN.OCCOc1ccc(Cl)cc1CN1CCCC1 |
| InChI | InChI=1S/C13H18ClNO2.CH5N/c14-12-3-4-13(17-8-7-16)11(9-12)10-15-5-1-2-6-15;1-2/h3-4,9,16H,1-2,5-8,10H2;2H2,1H3 |
| InChIKey | MYJILAKAOLJGJP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |