C12H17ClO4 — CID 83943367
4-(5-chloro-2,4-dimethoxyphenyl)butane-1,2-diol (PubChem CID 83943367) has the molecular formula C12H17ClO4 and a molecular weight of 260.72 g/mol. Its IUPAC name is 4-(5-chloro-2,4-dimethoxyphenyl)butane-1,2-diol.
| Compound Name | 4-(5-chloro-2,4-dimethoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 83943367 |
| Molecular Formula | C12H17ClO4 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(5-chloro-2,4-dimethoxyphenyl)butane-1,2-diol |
| SMILES | COc1cc(OC)c(CCC(O)CO)cc1Cl |
| InChI | InChI=1S/C12H17ClO4/c1-16-11-6-12(17-2)10(13)5-8(11)3-4-9(15)7-14/h5-6,9,14-15H,3-4,7H2,1-2H3 |
| InChIKey | FKDYVVHZPFGZTF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |