C14H17ClO2 — CID 83943340
1-chloro-5-hex-3-ynyl-2,4-dimethoxybenzene (PubChem CID 83943340) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 1-chloro-5-hex-3-ynyl-2,4-dimethoxybenzene.
| Compound Name | 1-chloro-5-hex-3-ynyl-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 83943340 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-chloro-5-hex-3-ynyl-2,4-dimethoxybenzene |
| SMILES | CCC#CCCc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C14H17ClO2/c1-4-5-6-7-8-11-9-12(15)14(17-3)10-13(11)16-2/h9-10H,4,7-8H2,1-3H3 |
| InChIKey | LVVYKWPJKCVWDX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|