C15H24BrNO — CID 83921957
4-amino-1-(2-bromo-4,5-dimethylphenyl)heptan-3-ol (PubChem CID 83921957) has the molecular formula C15H24BrNO and a molecular weight of 314.27 g/mol. Its IUPAC name is 4-amino-1-(2-bromo-4,5-dimethylphenyl)heptan-3-ol.
| Compound Name | 4-amino-1-(2-bromo-4,5-dimethylphenyl)heptan-3-ol |
|---|---|
| PubChem CID | 83921957 |
| Molecular Formula | C15H24BrNO |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-amino-1-(2-bromo-4,5-dimethylphenyl)heptan-3-ol |
| SMILES | CCCC(N)C(O)CCc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C15H24BrNO/c1-4-5-14(17)15(18)7-6-12-8-10(2)11(3)9-13(12)16/h8-9,14-15,18H,4-7,17H2,1-3H3 |
| InChIKey | KXBXDSZVHSKGDV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |