C13H20BrN — CID 83921907
5-(2-bromo-4,5-dimethylphenyl)pentan-2-amine (PubChem CID 83921907) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is 5-(2-bromo-4,5-dimethylphenyl)pentan-2-amine.
| Compound Name | 5-(2-bromo-4,5-dimethylphenyl)pentan-2-amine |
|---|---|
| PubChem CID | 83921907 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-(2-bromo-4,5-dimethylphenyl)pentan-2-amine |
| SMILES | Cc1cc(Br)c(CCCC(C)N)cc1C |
| InChI | InChI=1S/C13H20BrN/c1-9-7-12(6-4-5-11(3)15)13(14)8-10(9)2/h7-8,11H,4-6,15H2,1-3H3 |
| InChIKey | LMRGAWHZIHTNJJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |