C11H14Br2 — CID 83921853
1-bromo-2-(3-bromopropyl)-4,5-dimethylbenzene (PubChem CID 83921853) has the molecular formula C11H14Br2 and a molecular weight of 306.04 g/mol. Its IUPAC name is 1-bromo-2-(3-bromopropyl)-4,5-dimethylbenzene.
| Compound Name | 1-bromo-2-(3-bromopropyl)-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 83921853 |
| Molecular Formula | C11H14Br2 |
| Molecular Weight | 306.04 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 1-bromo-2-(3-bromopropyl)-4,5-dimethylbenzene |
| SMILES | Cc1cc(Br)c(CCCBr)cc1C |
| InChI | InChI=1S/C11H14Br2/c1-8-6-10(4-3-5-12)11(13)7-9(8)2/h6-7H,3-5H2,1-2H3 |
| InChIKey | MQQFUNIJKJRRTD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.04 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|