C22H36O — CID 83935649
4-tert-butyl-2-[(Z)-non-6-en-4-yl]-1-propoxybenzene (PubChem CID 83935649) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 4-tert-butyl-2-[(Z)-non-6-en-4-yl]-1-propoxybenzene.
| Compound Name | 4-tert-butyl-2-[(Z)-non-6-en-4-yl]-1-propoxybenzene |
|---|---|
| PubChem CID | 83935649 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 4-tert-butyl-2-[(Z)-non-6-en-4-yl]-1-propoxybenzene |
| SMILES | CC/C=C\CC(CCC)c1cc(C(C)(C)C)ccc1OCCC |
| InChI | InChI=1S/C22H36O/c1-7-10-11-13-18(12-8-2)20-17-19(22(4,5)6)14-15-21(20)23-16-9-3/h10-11,14-15,17-18H,7-9,12-13,16H2,1-6H3/b11-10- |
| InChIKey | AZEDBIOMCGNUBO-KHPPLWFESA-N |
| XLogP | 7.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|