C18H28O — CID 83935642
4-tert-butyl-2-[(Z)-pent-3-enyl]-1-propoxybenzene (PubChem CID 83935642) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 4-tert-butyl-2-[(Z)-pent-3-enyl]-1-propoxybenzene.
| Compound Name | 4-tert-butyl-2-[(Z)-pent-3-enyl]-1-propoxybenzene |
|---|---|
| PubChem CID | 83935642 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 4-tert-butyl-2-[(Z)-pent-3-enyl]-1-propoxybenzene |
| SMILES | C/C=C\CCc1cc(C(C)(C)C)ccc1OCCC |
| InChI | InChI=1S/C18H28O/c1-6-8-9-10-15-14-16(18(3,4)5)11-12-17(15)19-13-7-2/h6,8,11-12,14H,7,9-10,13H2,1-5H3/b8-6- |
| InChIKey | AICDSRJCOBZZJT-VURMDHGXSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|