C18H30ClNO — CID 83940695
4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)heptan-1-amine (PubChem CID 83940695) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is 4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)heptan-1-amine.
| Compound Name | 4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)heptan-1-amine |
|---|---|
| PubChem CID | 83940695 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 4-(3-chloro-2,5-dimethyl-6-propoxyphenyl)heptan-1-amine |
| SMILES | CCCOc1c(C)cc(Cl)c(C)c1C(CCC)CCCN |
| InChI | InChI=1S/C18H30ClNO/c1-5-8-15(9-7-10-20)17-14(4)16(19)12-13(3)18(17)21-11-6-2/h12,15H,5-11,20H2,1-4H3 |
| InChIKey | PMXJHCMIOYRUGB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |