C17H25FO3 — CID 83923153
2-[2-(4,5-diethoxy-2-fluorophenyl)propyl]-3-ethyloxirane (PubChem CID 83923153) has the molecular formula C17H25FO3 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[2-(4,5-diethoxy-2-fluorophenyl)propyl]-3-ethyloxirane.
| Compound Name | 2-[2-(4,5-diethoxy-2-fluorophenyl)propyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83923153 |
| Molecular Formula | C17H25FO3 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[2-(4,5-diethoxy-2-fluorophenyl)propyl]-3-ethyloxirane |
| SMILES | CCOc1cc(F)c(C(C)CC2OC2CC)cc1OCC |
| InChI | InChI=1S/C17H25FO3/c1-5-14-17(21-14)8-11(4)12-9-15(19-6-2)16(20-7-3)10-13(12)18/h9-11,14,17H,5-8H2,1-4H3 |
| InChIKey | QSSZGEOAJRJKRW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|