C14H17FO3 — CID 83922551
6-fluoro-7-[1-(3-methyloxiran-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 83922551) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is 6-fluoro-7-[1-(3-methyloxiran-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-fluoro-7-[1-(3-methyloxiran-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 83922551 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 6-fluoro-7-[1-(3-methyloxiran-2-yl)propan-2-yl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC(CC1OC1C)c1cc2c(cc1F)OCCO2 |
| InChI | InChI=1S/C14H17FO3/c1-8(5-12-9(2)18-12)10-6-13-14(7-11(10)15)17-4-3-16-13/h6-9,12H,3-5H2,1-2H3 |
| InChIKey | DWRYVFKPBFHGDS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|