C22H36O5 — CID 4222961
17,18-di(butan-2-yl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene (PubChem CID 4222961) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is 17,18-di(butan-2-yl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene.
| Compound Name | 17,18-di(butan-2-yl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
|---|---|
| PubChem CID | 4222961 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 17,18-di(butan-2-yl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
| SMILES | CCC(C)c1cc2c(cc1C(C)CC)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C22H36O5/c1-5-17(3)19-15-21-22(16-20(19)18(4)6-2)27-14-12-25-10-8-23-7-9-24-11-13-26-21/h15-18H,5-14H2,1-4H3 |
| InChIKey | XHJKANYIENENGN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |