C13H18O2 — CID 155120601
7-ethyl-6-propan-2-yl-2,3-dihydro-1,4-benzodioxine (PubChem CID 155120601) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 7-ethyl-6-propan-2-yl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-ethyl-6-propan-2-yl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 155120601 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 7-ethyl-6-propan-2-yl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCc1cc2c(cc1C(C)C)OCCO2 |
| InChI | InChI=1S/C13H18O2/c1-4-10-7-12-13(15-6-5-14-12)8-11(10)9(2)3/h7-9H,4-6H2,1-3H3 |
| InChIKey | RIAZVEXSWYLSTF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |