C25H34O6 — CID 7780742
11-[(2S)-pentan-2-yl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene (PubChem CID 7780742) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 11-[(2S)-pentan-2-yl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene.
| Compound Name | 11-[(2S)-pentan-2-yl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene |
|---|---|
| PubChem CID | 7780742 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 11-[(2S)-pentan-2-yl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene |
| SMILES | CCC[C@H](C)c1ccc2c(c1)OCCOCCOc1ccccc1OCCOCCO2 |
| InChI | InChI=1S/C25H34O6/c1-3-6-20(2)21-9-10-24-25(19-21)31-18-14-27-12-16-29-23-8-5-4-7-22(23)28-15-11-26-13-17-30-24/h4-5,7-10,19-20H,3,6,11-18H2,1-2H3/t20-/m0/s1 |
| InChIKey | BJXCDWOOVFYRPC-FQEVSTJZSA-N |
| XLogP | 4.85 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |