C16H22Br2O5 — CID 11419643
17,18-bis(bromomethyl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene (PubChem CID 11419643) has the molecular formula C16H22Br2O5 and a molecular weight of 454.16 g/mol. Its IUPAC name is 17,18-bis(bromomethyl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene.
| Compound Name | 17,18-bis(bromomethyl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
|---|---|
| PubChem CID | 11419643 |
| Molecular Formula | C16H22Br2O5 |
| Molecular Weight | 454.16 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | 17,18-bis(bromomethyl)-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene |
| SMILES | BrCc1cc2c(cc1CBr)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C16H22Br2O5/c17-11-13-9-15-16(10-14(13)12-18)23-8-6-21-4-2-19-1-3-20-5-7-22-15/h9-10H,1-8,11-12H2 |
| InChIKey | WEDLLHJVTFTYIS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|