C12H14FNO2S — CID 83922500
3-(6-fluoro-2,3-dihydro-1,4-benzodioxin-7-yl)butanethioamide (PubChem CID 83922500) has the molecular formula C12H14FNO2S and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-(6-fluoro-2,3-dihydro-1,4-benzodioxin-7-yl)butanethioamide.
| Compound Name | 3-(6-fluoro-2,3-dihydro-1,4-benzodioxin-7-yl)butanethioamide |
|---|---|
| PubChem CID | 83922500 |
| Molecular Formula | C12H14FNO2S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(6-fluoro-2,3-dihydro-1,4-benzodioxin-7-yl)butanethioamide |
| SMILES | CC(CC(N)=S)c1cc2c(cc1F)OCCO2 |
| InChI | InChI=1S/C12H14FNO2S/c1-7(4-12(14)17)8-5-10-11(6-9(8)13)16-3-2-15-10/h5-7H,2-4H2,1H3,(H2,14,17) |
| InChIKey | JXMKHEKAVKPAFQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|