C13H17F2N — CID 70897405
(2S,5R)-2-[2-(3,4-difluorophenyl)ethyl]-5-methylpyrrolidine (PubChem CID 70897405) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is (2S,5R)-2-[2-(3,4-difluorophenyl)ethyl]-5-methylpyrrolidine.
| Compound Name | (2S,5R)-2-[2-(3,4-difluorophenyl)ethyl]-5-methylpyrrolidine |
|---|---|
| PubChem CID | 70897405 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (2S,5R)-2-[2-(3,4-difluorophenyl)ethyl]-5-methylpyrrolidine |
| SMILES | C[C@@H]1CC[C@H](CCc2ccc(F)c(F)c2)N1 |
| InChI | InChI=1S/C13H17F2N/c1-9-2-5-11(16-9)6-3-10-4-7-12(14)13(15)8-10/h4,7-9,11,16H,2-3,5-6H2,1H3/t9-,11-/m1/s1 |
| InChIKey | PCWJSVMXOOMHOZ-MWLCHTKSSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |