C22H32F2Si — CID 54106542
CID 54106542 (PubChem CID 54106542) has the molecular formula C22H32F2Si and a molecular weight of 362.58 g/mol.
| Compound Name | CID 54106542 |
|---|---|
| PubChem CID | 54106542 |
| Molecular Formula | C22H32F2Si |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | — |
| SMILES | C[Si]CC1CCC(C2CCC(CCc3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H32F2Si/c1-25-15-18-6-11-20(12-7-18)19-9-4-16(5-10-19)2-3-17-8-13-21(23)22(24)14-17/h8,13-14,16,18-20H,2-7,9-12,15H2,1H3 |
| InChIKey | KQJZZYOZCLBNIY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|