C30H42F2Si — CID 19420002
4-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-pentyl-1-phenylsilinane (PubChem CID 19420002) has the molecular formula C30H42F2Si and a molecular weight of 468.75 g/mol. Its IUPAC name is 4-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-pentyl-1-phenylsilinane.
| Compound Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-pentyl-1-phenylsilinane |
|---|---|
| PubChem CID | 19420002 |
| Molecular Formula | C30H42F2Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 4-[4-[2-(3,4-difluorophenyl)ethyl]cyclohexyl]-1-pentyl-1-phenylsilinane |
| SMILES | CCCCC[Si]1(c2ccccc2)CCC(C2CCC(CCc3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H42F2Si/c1-2-3-7-20-33(28-8-5-4-6-9-28)21-18-27(19-22-33)26-15-12-24(13-16-26)10-11-25-14-17-29(31)30(32)23-25/h4-6,8-9,14,17,23-24,26-27H,2-3,7,10-13,15-16,18-22H2,1H3 |
| InChIKey | ABQMRFTXNBVWBO-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|