C24H38F2OSi — CID 86196860
4-[4-(2,2-difluoroethoxy)cyclohexyl]-1-pentyl-1-phenylsilinane (PubChem CID 86196860) has the molecular formula C24H38F2OSi and a molecular weight of 408.65 g/mol. Its IUPAC name is 4-[4-(2,2-difluoroethoxy)cyclohexyl]-1-pentyl-1-phenylsilinane.
| Compound Name | 4-[4-(2,2-difluoroethoxy)cyclohexyl]-1-pentyl-1-phenylsilinane |
|---|---|
| PubChem CID | 86196860 |
| Molecular Formula | C24H38F2OSi |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 4-[4-(2,2-difluoroethoxy)cyclohexyl]-1-pentyl-1-phenylsilinane |
| SMILES | CCCCC[Si]1(c2ccccc2)CCC(C2CCC(OCC(F)F)CC2)CC1 |
| InChI | InChI=1S/C24H38F2OSi/c1-2-3-7-16-28(23-8-5-4-6-9-23)17-14-21(15-18-28)20-10-12-22(13-11-20)27-19-24(25)26/h4-6,8-9,20-22,24H,2-3,7,10-19H2,1H3 |
| InChIKey | NLEODNJVGGGXIM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|