C23H37BrSi — CID 22913891
4-[4-(3-bromopropyl)cyclohexyl]-1-phenyl-1-propylsilinane (PubChem CID 22913891) has the molecular formula C23H37BrSi and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[4-(3-bromopropyl)cyclohexyl]-1-phenyl-1-propylsilinane.
| Compound Name | 4-[4-(3-bromopropyl)cyclohexyl]-1-phenyl-1-propylsilinane |
|---|---|
| PubChem CID | 22913891 |
| Molecular Formula | C23H37BrSi |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[4-(3-bromopropyl)cyclohexyl]-1-phenyl-1-propylsilinane |
| SMILES | CCC[Si]1(c2ccccc2)CCC(C2CCC(CCCBr)CC2)CC1 |
| InChI | InChI=1S/C23H37BrSi/c1-2-17-25(23-8-4-3-5-9-23)18-14-22(15-19-25)21-12-10-20(11-13-21)7-6-16-24/h3-5,8-9,20-22H,2,6-7,10-19H2,1H3 |
| InChIKey | QVUKMDRXQZCKLS-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|