C22H34O2Si — CID 23354830
4-(1-butyl-1-phenylsilinan-4-yl)cyclohexane-1-carboxylic acid (PubChem CID 23354830) has the molecular formula C22H34O2Si and a molecular weight of 358.60 g/mol. Its IUPAC name is 4-(1-butyl-1-phenylsilinan-4-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(1-butyl-1-phenylsilinan-4-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 23354830 |
| Molecular Formula | C22H34O2Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 4-(1-butyl-1-phenylsilinan-4-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCCC[Si]1(c2ccccc2)CCC(C2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C22H34O2Si/c1-2-3-15-25(21-7-5-4-6-8-21)16-13-19(14-17-25)18-9-11-20(12-10-18)22(23)24/h4-8,18-20H,2-3,9-17H2,1H3,(H,23,24) |
| InChIKey | FLXHCGKRGPVBJA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|