C26H40O2 — CID 18659085
4-[4-butyl-4-(4-propylphenyl)cyclohexyl]cyclohexane-1-carboxylic acid (PubChem CID 18659085) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 4-[4-butyl-4-(4-propylphenyl)cyclohexyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-butyl-4-(4-propylphenyl)cyclohexyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 18659085 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 4-[4-butyl-4-(4-propylphenyl)cyclohexyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCC1(c2ccc(CCC)cc2)CCC(C2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C26H40O2/c1-3-5-17-26(24-13-7-20(6-4-2)8-14-24)18-15-22(16-19-26)21-9-11-23(12-10-21)25(27)28/h7-8,13-14,21-23H,3-6,9-12,15-19H2,1-2H3,(H,27,28) |
| InChIKey | KDQBMAATXJHNKS-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |