C18H30F2O — CID 163752079
1-butan-2-ylidene-4-[4-(2,2-difluoroethoxy)cyclohexyl]cyclohexane (PubChem CID 163752079) has the molecular formula C18H30F2O and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-butan-2-ylidene-4-[4-(2,2-difluoroethoxy)cyclohexyl]cyclohexane.
| Compound Name | 1-butan-2-ylidene-4-[4-(2,2-difluoroethoxy)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 163752079 |
| Molecular Formula | C18H30F2O |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-butan-2-ylidene-4-[4-(2,2-difluoroethoxy)cyclohexyl]cyclohexane |
| SMILES | CCC(C)=C1CCC(C2CCC(OCC(F)F)CC2)CC1 |
| InChI | InChI=1S/C18H30F2O/c1-3-13(2)14-4-6-15(7-5-14)16-8-10-17(11-9-16)21-12-18(19)20/h15-18H,3-12H2,1-2H3/b14-13- |
| InChIKey | LQVPKMKRSWFUSE-YPKPFQOOSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|