C19H32F2O — CID 19842753
1-(2,2-difluoroethenyl)-4-(4-pentoxycyclohexyl)cyclohexane (PubChem CID 19842753) has the molecular formula C19H32F2O and a molecular weight of 314.46 g/mol. Its IUPAC name is 1-(2,2-difluoroethenyl)-4-(4-pentoxycyclohexyl)cyclohexane.
| Compound Name | 1-(2,2-difluoroethenyl)-4-(4-pentoxycyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 19842753 |
| Molecular Formula | C19H32F2O |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 1-(2,2-difluoroethenyl)-4-(4-pentoxycyclohexyl)cyclohexane |
| SMILES | CCCCCOC1CCC(C2CCC(C=C(F)F)CC2)CC1 |
| InChI | InChI=1S/C19H32F2O/c1-2-3-4-13-22-18-11-9-17(10-12-18)16-7-5-15(6-8-16)14-19(20)21/h14-18H,2-13H2,1H3 |
| InChIKey | SRBXXNUFFFXYLW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|