C17H24F2O3 — CID 19436106
2-[2-(difluoromethoxy)phenyl]-5-hexyl-1,3-dioxane (PubChem CID 19436106) has the molecular formula C17H24F2O3 and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)phenyl]-5-hexyl-1,3-dioxane.
| Compound Name | 2-[2-(difluoromethoxy)phenyl]-5-hexyl-1,3-dioxane |
|---|---|
| PubChem CID | 19436106 |
| Molecular Formula | C17H24F2O3 |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-[2-(difluoromethoxy)phenyl]-5-hexyl-1,3-dioxane |
| SMILES | CCCCCCC1COC(c2ccccc2OC(F)F)OC1 |
| InChI | InChI=1S/C17H24F2O3/c1-2-3-4-5-8-13-11-20-16(21-12-13)14-9-6-7-10-15(14)22-17(18)19/h6-7,9-10,13,16-17H,2-5,8,11-12H2,1H3 |
| InChIKey | FHLPTPRJSMOISB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|