C23H24F6O4 — CID 20653885
2-[4-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 20653885) has the molecular formula C23H24F6O4 and a molecular weight of 478.43 g/mol. Its IUPAC name is 2-[4-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 20653885 |
| Molecular Formula | C23H24F6O4 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-[4-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2cc(F)c(C(F)(F)Oc3ccc(OC(F)F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C23H24F6O4/c1-2-3-4-5-14-12-30-21(31-13-14)15-10-18(24)20(19(25)11-15)23(28,29)33-17-8-6-16(7-9-17)32-22(26)27/h6-11,14,21-22H,2-5,12-13H2,1H3 |
| InChIKey | IBOGWXIGQHJDME-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|