C23H22F8O4 — CID 20653938
2-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 20653938) has the molecular formula C23H22F8O4 and a molecular weight of 514.41 g/mol. Its IUPAC name is 2-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 20653938 |
| Molecular Formula | C23H22F8O4 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[4-[difluoro-[3-fluoro-4-(trifluoromethoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2cc(F)c(C(F)(F)Oc3ccc(OC(F)(F)F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C23H22F8O4/c1-2-3-4-5-13-11-32-21(33-12-13)14-8-17(25)20(18(26)9-14)22(27,28)34-15-6-7-19(16(24)10-15)35-23(29,30)31/h6-10,13,21H,2-5,11-12H2,1H3 |
| InChIKey | SIYMBBSMMYWVMD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|