C25H24F8O4 — CID 123484873
2-[4-[difluoro-[3-fluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 123484873) has the molecular formula C25H24F8O4 and a molecular weight of 540.45 g/mol. Its IUPAC name is 2-[4-[difluoro-[3-fluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[difluoro-[3-fluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 123484873 |
| Molecular Formula | C25H24F8O4 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | 2-[4-[difluoro-[3-fluoro-4-(3,3,3-trifluoroprop-1-enoxy)phenoxy]methyl]-3,5-difluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2cc(F)c(C(F)(F)Oc3ccc(OC=CC(F)(F)F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C25H24F8O4/c1-2-3-4-5-15-13-35-23(36-14-15)16-10-19(27)22(20(28)11-16)25(32,33)37-17-6-7-21(18(26)12-17)34-9-8-24(29,30)31/h6-12,15,23H,2-5,13-14H2,1H3 |
| InChIKey | LPXNRBHCTBLNCW-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|