C31H38F6O2 — CID 20653958
2-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]benzene (PubChem CID 20653958) has the molecular formula C31H38F6O2 and a molecular weight of 556.63 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 2-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 20653958 |
| Molecular Formula | C31H38F6O2 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohexyl)cyclohexyl]benzene |
| SMILES | CCCCCC1CCC(C2CCC(c3cc(F)c(C(F)(F)Oc4ccc(OC(F)F)cc4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C31H38F6O2/c1-2-3-4-5-20-6-8-21(9-7-20)22-10-12-23(13-11-22)24-18-27(32)29(28(33)19-24)31(36,37)39-26-16-14-25(15-17-26)38-30(34)35/h14-23,30H,2-13H2,1H3 |
| InChIKey | ABGQEBSHKPVNFK-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|