C24H34F2O2 — CID 58021228
5-but-3-enyl-2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]oxane (PubChem CID 58021228) has the molecular formula C24H34F2O2 and a molecular weight of 392.53 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]oxane.
| Compound Name | 5-but-3-enyl-2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 58021228 |
| Molecular Formula | C24H34F2O2 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 5-but-3-enyl-2-[4-(2,3-difluoro-4-propoxyphenyl)cyclohexyl]oxane |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(OCCC)c(F)c3F)CC2)OC1 |
| InChI | InChI=1S/C24H34F2O2/c1-3-5-6-17-7-13-21(28-16-17)19-10-8-18(9-11-19)20-12-14-22(27-15-4-2)24(26)23(20)25/h3,12,14,17-19,21H,1,4-11,13,15-16H2,2H3 |
| InChIKey | KMRCMFYSIFNXKI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|