C33H48F2O2 — CID 58021165
5-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane (PubChem CID 58021165) has the molecular formula C33H48F2O2 and a molecular weight of 514.74 g/mol. Its IUPAC name is 5-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane.
| Compound Name | 5-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 58021165 |
| Molecular Formula | C33H48F2O2 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 5-[4-(4-ethenylcyclohexyl)cyclohexyl]-2-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]oxane |
| SMILES | C=CC1CCC(C2CCC(C3CCC(C4CCC(c5ccc(OCC)c(F)c5F)CC4)OC3)CC2)CC1 |
| InChI | InChI=1S/C33H48F2O2/c1-3-22-5-7-23(8-6-22)24-9-11-25(12-10-24)28-17-19-30(37-21-28)27-15-13-26(14-16-27)29-18-20-31(36-4-2)33(35)32(29)34/h3,18,20,22-28,30H,1,4-17,19,21H2,2H3 |
| InChIKey | YZQHSRRWAQKOOV-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|