C29H40F2O3 — CID 149417043
[4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-ethenylcyclohexane-1-carboxylate (PubChem CID 149417043) has the molecular formula C29H40F2O3 and a molecular weight of 474.63 g/mol. Its IUPAC name is [4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-ethenylcyclohexane-1-carboxylate.
| Compound Name | [4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-ethenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 149417043 |
| Molecular Formula | C29H40F2O3 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | [4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-ethenylcyclohexane-1-carboxylate |
| SMILES | C=CC1CCC(C(=O)OC2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)CC2)CC1 |
| InChI | InChI=1S/C29H40F2O3/c1-3-19-5-7-23(8-6-19)29(32)34-24-15-13-21(14-16-24)20-9-11-22(12-10-20)25-17-18-26(33-4-2)28(31)27(25)30/h3,17-24H,1,4-16H2,2H3 |
| InChIKey | YSJOZESHFOQFFZ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|